Details for Diphenylacetic Acid
Diphenylacetic Acid
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
117-34-0 |
EC NO: |
204-185-0 |
Molecular Formula: |
C14H12O2 |
Molecular Weight: |
212.2439 |
Specification: |
|
InChI: |
InChI=1/C14H12O2/c15-14(16)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13H,(H,15,16) |
Packing: |
40 Kg fibreboard kegs with polythene inner bag |
Synonyms: |
Benzeneacetic acid, alpha-phenyl-;2,2-Diphenylacetic Acid; |
Molecular Structure: |
|
if you are sourcing Diphenylacetic Acid from Italy ,just feel free to inquire