Details for Hexanoic acid
![](/images/home/newal1.gif)
Hexanoic acid
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
142-62-1 |
EC NO: |
205-550-7 |
Molecular Formula: |
C6H12O2 |
Molecular Weight: |
116.18 |
Specification: |
|
InChI: |
InChI=1/C6H12O2/c1-2-3-4-5-6(7)8/h2-5H2,1H3,(H,7,8)/p-1 |
Synonyms: |
N-caproic acid sigma grade;Caproic acid;N-CAPRONIC ACID;Natural Hexanoic Acid;hexanoate;n-Caproic acid;Hexanoic Acid (n-Caproic Acid, C6);N-Hexanoic Acid; |
Molecular Structure: |
![Hexanoic acid 142-62-1](https://images-a.chemnet.com/suppliers/chembase/165/1652.gif) |
if you are sourcing Hexanoic acid from Japan ,just feel free to inquire