Details for 1-Methyl amino anthraquinone
1-Methyl amino anthraquinone
111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
82-38-2 |
EC NO: |
201-417-2 |
Molecular Formula: |
C15H11NO2 |
Molecular Weight: |
237.2533 |
Specification: |
|
InChI: |
InChI=1/C15H11NO2/c1-16-12-8-4-7-11-13(12)15(18)10-6-3-2-5-9(10)14(11)17/h2-8,16H,1H3 |
Synonyms: |
C.I. 60505;C.I. Disperse Red 9;C.I. Solvent Red 111;Disperse red 9;Solvent Red 111;Transparent Red GS;C.I.Solvent Red 111;1-Methylamino anthraquinone;Red GS;1-(methylamino)anthracene-9,10-dione;Plast red 3002;1-Methylaminoanthraquinone;Solvent Red 2R; |
Molecular Structure: |
|
if you are sourcing 1-Methyl amino anthraquinone from Japan ,just feel free to inquire