Details for Para-amino phenol
![](/images/home/newal1.gif)
Para-amino phenol
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
123-30-8 |
EC NO: |
204-616-2 |
Molecular Formula: |
C6H7NO |
Molecular Weight: |
109.1259 |
Specification: |
|
InChI: |
InChI=1/C6H7NO/c7-5-1-3-6(8)4-2-5/h1-4,8H,7H2 |
Synonyms: |
C.I. 76550;C.I. Oxidation Base 6;4-Hydroxyaniline;P-Aminophenol;P-Amino phenol;4-Amino-1-hydroxybenzene;para aminophenol;Para-aminophenol;1-amino-4-hydroxybenzene 4-Amino phenol; |
Molecular Structure: |
![Para-amino phenol 123-30-8](https://images-a.chemnet.com/suppliers/chembase/349/349.gif) |
if you are sourcing Para-amino phenol from Japan ,just feel free to inquire