Details for polyurethane

polyurethane
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
9009-54-5 |
EC NO: |
210-898-8 |
Molecular Formula: |
C3H8N2O |
Molecular Weight: |
88.1084 |
Specification: |
|
InChI: |
InChI=1/C3H8N2O/c1-2-5-3(4)6/h2H2,1H3,(H3,4,5,6) |
Synonyms: |
Polyurethane foam;Polyurethane foams;Polyisocyanurate resins;Polyurethanes, cellular;PU foam;The following companies react isocyanates or prepolymers with polyols to produce polyurethane foams. The list is incomplete.;POLYURETHANEOLIGOMERS;POLYURETHANEVARNISH;PU;Acrylic polyurethane paint;Acrylic polyurethane anticorrosive coating;Polyurethane mixed component;1-ethylurea; |
Molecular Structure: |
 |
if you are sourcing polyurethane from Japan ,just feel free to inquire