Details for Methyl Ethyl Ketone

Methyl Ethyl Ketone
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
78-93-3 |
EC NO: |
201-159-0 |
Molecular Formula: |
C4H8O |
Molecular Weight: |
72.1057 |
Specification: |
|
InChI: |
InChI=1/C4H8O/c1-3-4(2)5/h3H2,1-2H3 |
Product description:
Methyl ethyl ketone CAS: 78-93-3 Formula: C4H8O Ethyl methyl ketone Butanone MEK Methyl acetone Butan-2-one PubChem: 6569 EC (EINECS/ELINCS): 201-159-0 EC Index Number: 606-002-00-3 RTECS: EL6475000 UN: 1193 Merck: 12,6149 Beilstein/Gmelin: 741880 Beilstein Reference: 4-01-00-03243 RCRA: U159 EPA OPP |
Synonyms: |
MEK;Methyl ethyl ketone;2-Butanone (Controlled Chemical);Ethylmethylketone,99%;Ethyl methyl ketone~MEK~Methyl ethyl ketone;Ethyl methyl ketone;butan-2-one; |
Molecular Structure: |
 |
if you are sourcing Methyl Ethyl Ketone from South-Africa ,just feel free to inquire