Details for isostearyl isostearate
![](/images/home/newal1.gif)
isostearyl isostearate
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
41669-30-1 |
EC NO: |
255-485-3 |
Molecular Formula: |
C36H72O2 |
Molecular Weight: |
536.9557 |
Specification: |
|
InChI: |
InChI=1/C36H72O2/c1-34(2)30-26-22-18-14-10-6-5-9-13-17-21-25-29-33-38-36(37)32-28-24-20-16-12-8-7-11-15-19-23-27-31-35(3)4/h34-35H,5-33H2,1-4H3 |
Synonyms: |
Isooctadecanoic acid, isooctadecyl ester;Isostearyl isostearate;16-Methylheptadecanoic acid, 16-methylheptadecyl ester;Isooctadecyl isooctadecanoate;16-methylheptadecyl 16-methylheptadecanoate; |
Molecular Structure: |
![isostearyl isostearate 41669-30-1](https://images-a.chemnet.com/suppliers/chembase/cas4/cas41669-30-1.gif) |
if you are sourcing isostearyl isostearate from United-States ,just feel free to inquire