Details for (R)- 3- Hydroxybutyric acid methyl ester

(R)- 3- Hydroxybutyric acid methyl ester
111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
3976-69-0 |
EC NO: |
223-610-0 |
Molecular Formula: |
C5H10O3 |
Molecular Weight: |
118.1311 |
Specification: |
|
InChI: |
InChI=1/C5H10O3/c1-4(6)3-5(7)8-2/h4,6H,3H2,1-2H3/t4-/m1/s1 |
Synonyms: |
(R)-(-)-methyl 3-hydroxybutyrate;methyl (r)-(-)-3-hydroxybutyrate;methyl d-(r)-3-hydroxybutyrate;(r)-(-)-3-hydroxybutyric acid methyl ester;(r)-3-hydroxybutyric acid methyl ester;(r)-(-)-3-hydroxy-n-butyric acid methyl ester;(r)-methyl 3-hydroxybutanoate;methyl (3R)-3-hydroxybutanoate;methyl 3-hydroxybutyrate;Butyric acid, 3-hydroxy-, methyl ester;Methyl 3-hydroxybutyrate;methyl 3-hydroxybutanoate; |
Molecular Structure: |
 |
if you are sourcing (R)- 3- Hydroxybutyric acid methyl ester from Switzerland ,just feel free to inquire