Details for 4-Methoxyphenylacetic acid

4-Methoxyphenylacetic acid
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
104-01-8 |
| EC NO: |
203-166-4 |
| Molecular Formula: |
C8H8O3 |
| Molecular Weight: |
152.1473 |
| Specification: |
|
| InChI: |
InChI=1/C8H8O3/c1-10-7-2-4-8(5-3-7)11-6-9/h2-6H,1H3 |
| Synonyms: |
p-Methoxyphenylacetic acid;4-MethoxyPhenylAceticAcid;4-methoxy phenylacetic acid;Para methoxy phenyl acetic acid;4-methoxybenzyl formate;4-methoxyphenyl formate;4-MPAA; |
| Molecular Structure: |
 |
if you are sourcing 4-Methoxyphenylacetic acid from Switzerland ,just feel free to inquire