Details for Acetoacetic acid allyl ester
Acetoacetic acid allyl ester
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
1118-84-9 |
EC NO: |
214-269-9 |
Molecular Formula: |
C7H10O3 |
Molecular Weight: |
142.1525 |
Specification: |
|
InChI: |
InChI=1/C7H10O3/c1-3-4-10-7(9)5-6(2)8/h3H,1,4-5H2,2H3 |
Synonyms: |
Allylacetoacetate;(2-Propenyl) 3-oxobutanoate;2-Propenyl acetoacetate;Allyl acetoacetate;Allyl aceto acetate;prop-2-en-1-yl 3-oxobutanoate; |
Molecular Structure: |
|
if you are sourcing Acetoacetic acid allyl ester from Switzerland ,just feel free to inquire