Details for Ethyl 3-aminocrotonate
Ethyl 3-aminocrotonate
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
626-34-6 |
EC NO: |
230-782-0 |
Molecular Formula: |
C6H11NO2 |
Molecular Weight: |
129.157 |
Specification: |
|
InChI: |
InChI=1/C6H11NO2/c1-3-9-6(8)4-5(2)7/h4H,3,7H2,1-2H3/b5-4- |
Synonyms: |
Beta-Aminocrotonic Acid Ethyl Ester;Crotonic Acid, 3-Amino-, Ethyl Ester;Ethyl (2e)-3-Amino-2-Butenoate;Ethyl 3-Amino-2-Butenoate;Ethyl (2e)-3-Aminobut-2-Enoate;Ethyl Beta-Aminocrotonate;Ethyl B-Iminobutyrate;3-Amino-2-Butenoic Acid Ethyl Ester;¦¢-Aminocrotonic Acid, Ethyl Ester;3-Aminocrotonic Acid Ethyl Ester;ethyl 3-aminobut-2-enoate;ethyl (3E)-3-iminobutanoate;ethyl (2Z)-3-aminobut-2-enoate;Ethyl ¦Â-aminocrotonate;Ethyl-3-aminocrotonate;ethyl aminocrotonate; |
Molecular Structure: |
|
if you are sourcing Ethyl 3-aminocrotonate from Switzerland ,just feel free to inquire