Details for Isobutyl nitrite
Isobutyl nitrite
111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
542-56-3 |
EC NO: |
208-819-7 |
Molecular Formula: |
C4H9NO2 |
Molecular Weight: |
103.1198 |
Specification: |
|
InChI: |
InChI=1/C4H9NO2/c1-4(2)3-7-5-6/h4H,3H2,1-2H3 |
Synonyms: |
4-01-00-01595 (Beilstein Handbook Reference);BRN 1699518;Blackjack;CCRIS 1099;HSDB 4368;IBN;NCI-C61052;Nitrous acid, 2-methylpropyl ester;Nitrous acid, isobutyl ester;2-methylpropyl nitrite;Isobutylnitrite; |
Molecular Structure: |
|
if you are sourcing Isobutyl nitrite from Switzerland ,just feel free to inquire