Details for Cetyl Stearyl Alcohol

Cetyl Stearyl Alcohol
111Category: |
Organic chemicals and Derivatives/Alcohol and aether compounds |
|
CAS NO: |
67762-27-0 |
EC NO: |
267-008-6 |
Molecular Formula: |
C34H70O |
Molecular Weight: |
494.919 |
Specification: |
|
InChI: |
InChI=1/C34H70O/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-34(35)32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h34-35H,3-33H2,1-2H3 |
Synonyms: |
Ceto-stearyl alcohol;Cetearyl alcohol;CETYL-STEARYL ALCOHOL;C1618;heptadecan-1-ol;hexadecan-1-ol - octadecan-1-ol (1:1);tetratriacontan-17-ol; |
Molecular Structure: |
 |
if you are sourcing Cetyl Stearyl Alcohol from United-Kingdom ,just feel free to inquire