Details for 2-Ethylhexyl Acetate
2-Ethylhexyl Acetate
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
103-09-3 |
EC NO: |
203-079-1 |
Molecular Formula: |
C10H20O2 |
Molecular Weight: |
172.2646 |
Specification: |
|
InChI: |
InChI=1/C10H20O2/c1-4-6-7-10(5-2)8-12-9(3)11/h10H,4-8H2,1-3H3/t10-/m1/s1 |
Synonyms: |
Iso-octyl acetate;2-Ethyl-1-hexanol acetate;2-Ethyl-1-hexyl acetate;2-Ethylhexanyl acetate;2-Ethylhexyl ethanoate;2-Ethylhexylester kyseliny octove [Czech];4-02-00-00166 (Beilstein Handbook Reference);AI3-07924;Acetic acid alpha-ethylhexyl ester;Acetic acid, 2-ethylhexyl ester;BRN 1758321;FEMA Number 2806;HSDB 2668;NSC 8897;beta-Ethylhexyl acetate;octan-3-yl acetate;(2R)-2-ethylhexyl acetate;IOAC;Acetic acid, isooctyl ester;Isooctanol, acetate;Acetic Acid Isooctyl Ester;Isooctyl acetate;2-ethyl hexyl acetate; |
Molecular Structure: |
|
if you are sourcing 2-Ethylhexyl Acetate from United-States ,just feel free to inquire