Details for Butyl Cellosolve

Butyl Cellosolve
111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
111-76-2 |
EC NO: |
203-905-0 |
Molecular Formula: |
C6H14O2 |
Molecular Weight: |
118.1742 |
Specification: |
|
InChI: |
InChI=1/C6H14O2/c1-3-4-5-8-6(2)7/h6-7H,3-5H2,1-2H3 |
Synonyms: |
2-butoxy-1-ethanol;monobutyl ether of ethylene glycol;monobutyl glycol ether;n-butoxyethanol;n-Butyl Cellosolve;poly-solv eb;2-BUTOXY ETHANOL (ETHYLENE GLYCOL MONOBUTYL ETHER);o-butyl ethylene glycol;2-n-Butoxy-1-ethanol;2-n-Butoxyethanol;3-oxa-1-heptanol;Beta-butoxyethanol;BUCS;butoxyethanol;Butyl cellosolve;butyl glycol;Butyl oxitol;Dowanol EB;Ektasolve EB;Ektasolve EB solvent;Ethylene glycol butyl ether;Ethylene glycol mono butyl ether;Ethylene glycol monobutyl ether (EGBE) (2-Butoxyet? Ethylene Glycol Mono-n-butyl Ether;Ethylene glycol n-butyl ether;gafcol eb;glycol butyl ether;glycol ether eb;glycol ether eb acetate;Jeffersol EB;ethylene glycol monobutyl ether;2-butoxyethanol;ethane-1,2-diol-1-butoxybutane (1:1);1-butoxyethanol;BCS; |
Molecular Structure: |
 |
if you are sourcing Butyl Cellosolve from United-States ,just feel free to inquire