Details for Dibenzyl phosphite

Dibenzyl phosphite
111Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
CAS NO: |
17176-77-1 |
EC NO: |
241-226-1 |
Molecular Formula: |
C14H15O3P |
Molecular Weight: |
262.2409 |
Specification: |
|
InChI: |
InChI=1/C14H15O3P/c15-18(16-11-13-7-3-1-4-8-13)17-12-14-9-5-2-6-10-14/h1-10,18H,11-12H2 |
Synonyms: |
Dibenzyl phosphonate;Phosphonic acid dibenzyl ester;Phosphorous acid dibenzyl ester;Bromine Hydride Acetic Acid;dibenzyl hydrogen phosphite; |
Molecular Structure: |
 |
if you are sourcing Dibenzyl phosphite from United-States ,just feel free to inquire