Details for 2-Chloro-5-fluoronicotinic acid ethyl ester
2-Chloro-5-fluoronicotinic acid ethyl ester
111Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
CAS NO: |
139911-30-1 |
EC NO: |
|
Molecular Formula: |
C8H7ClFNO2 |
Molecular Weight: |
203.5981 |
Specification: |
|
InChI: |
InChI=1/C8H7ClFNO2/c1-2-13-8(12)6-3-5(10)4-11-7(6)9/h3-4H,2H2,1H3 |
Synonyms: |
2-CHLORO-5-FLUORONICOTINIC ACID ETHYL ESTER;Ethyl2-Chloro-5-fluoronicotinicacid;2-CHLORO-5-FLUORONICOTONIC ACID ETHYL ESTER;ethyl 2-chloro-5-fluoropyridine-3-carboxylate; |
Molecular Structure: |
|
if you are sourcing 2-Chloro-5-fluoronicotinic acid ethyl ester from United-States ,just feel free to inquire