Details for 3-Fluoro-2-methyl benzoic acid
![](/images/home/newal1.gif)
3-Fluoro-2-methyl benzoic acid
111Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
CAS NO: |
699-90-1 |
EC NO: |
|
Molecular Formula: |
C8H7FO2 |
Molecular Weight: |
154.1384 |
Specification: |
|
InChI: |
InChI=1/C8H7FO2/c1-5-6(8(10)11)3-2-4-7(5)9/h2-4H,1H3,(H,10,11) |
Synonyms: |
3-Fluoro-2-methylbenzoic acid;2-Methyl-3-Fluoro Benzoic Acid;1-(2-deoxypentofuranosyl)-5-(trifluoromethyl)pyrimidine-2,4(1H,3H)-dione;3-Fluoro-2-Methyl-Benzoic Acid; |
Molecular Structure: |
![3-Fluoro-2-methyl benzoic acid 699-90-1](https://images-a.chemnet.com/suppliers/chembase/155/15522.gif) |
if you are sourcing 3-Fluoro-2-methyl benzoic acid from United-States ,just feel free to inquire