Details for 3-Fluoro-4-Bromo benzoic acid

3-Fluoro-4-Bromo benzoic acid
111Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
CAS NO: |
153556-42-4 |
EC NO: |
|
Molecular Formula: |
C7H3BrFO2 |
Molecular Weight: |
218.0005 |
Specification: |
|
InChI: |
InChI=1/C7H4BrFO2/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3H,(H,10,11)/p-1 |
Synonyms: |
BUTTPARK 20\01-57;3-Fluoro-4-Bromo Benzoic Acid;4-Bromo-3-fluorobenzoic;4-Bromo-3-fluorobenzoic acid, 98+%;4-bromo-3-fluoro benzoic acid;4-bromo-3-fluorobenzoate; |
Molecular Structure: |
 |
if you are sourcing 3-Fluoro-4-Bromo benzoic acid from United-States ,just feel free to inquire