Details for 5-Bromonicotinic acid methyl ester

5-Bromonicotinic acid methyl ester
111Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
CAS NO: |
29681-44-5 |
EC NO: |
|
Molecular Formula: |
C7H6BrNO2 |
Molecular Weight: |
216.032 |
Specification: |
|
InChI: |
InChI=1/C7H6BrNO2/c1-11-7(10)5-2-6(8)4-9-3-5/h2-4H,1H3 |
Synonyms: |
Methyl-5-bromo-3-pyridincarboxylate;5-Bromo nicotinic acid methyl ester;5-Bromonicotinic Acid Methyl Ester;Methyl 5-bromopyridine-3-carboxylate;5-Bromopyridine-3-carboxylic acid methyl ester; |
Molecular Structure: |
 |
if you are sourcing 5-Bromonicotinic acid methyl ester from United-States ,just feel free to inquire