Details for 6-Bromonicotinic acid methyl ester
![](/images/home/newal1.gif)
6-Bromonicotinic acid methyl ester
111Category: |
Organic chemicals and Derivatives/Alcohol and aether compounds |
|
CAS NO: |
26218-78-0 |
EC NO: |
|
Molecular Formula: |
C7H6BrNO2 |
Molecular Weight: |
216.032 |
Specification: |
|
InChI: |
InChI=1/C7H6BrNO2/c1-11-7(10)5-2-3-6(8)9-4-5/h2-4H,1H3 |
Synonyms: |
Methyl 6-bromonicotinate;methyl 6-bromopyridine-3-carboxylate;Methyl-6-bromonicotinate;Methyl 6-Bromo-Nicotinate; |
Molecular Structure: |
![6-Bromonicotinic acid methyl ester 26218-78-0](https://images-a.chemnet.com/suppliers/chembase/203/203549_1.gif) |
if you are sourcing 6-Bromonicotinic acid methyl ester from United-States ,just feel free to inquire