Details for 6-Chloronicotinic acid methyl ester
![](/images/home/newal1.gif)
6-Chloronicotinic acid methyl ester
111Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
CAS NO: |
73781-91-6 |
EC NO: |
|
Molecular Formula: |
C7H6ClNO2 |
Molecular Weight: |
171.581 |
Specification: |
|
InChI: |
InChI=1/C7H6ClNO2/c1-11-7(10)5-2-3-6(8)9-4-5/h2-4H,1H3 |
Synonyms: |
6-Chloronicotinic acid methyl ester;Methyl 6-chloropyridine-3-carboxylate;3-Pyridinecarboxylic acid, 6-chloro-, methyl ester; |
Molecular Structure: |
![6-Chloronicotinic acid methyl ester 73781-91-6](https://images-a.chemnet.com/suppliers/chembase/365/36519.gif) |
if you are sourcing 6-Chloronicotinic acid methyl ester from United-States ,just feel free to inquire