Details for Ethyl 2-methyl acetoacetate
![](/images/home/newal1.gif)
Ethyl 2-methyl acetoacetate
111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
609-14-3 |
EC NO: |
210-179-9 |
Molecular Formula: |
C7H12O3 |
Molecular Weight: |
144.1684 |
Specification: |
|
InChI: |
InChI=1/C7H12O3/c1-4-10-7(9)5(2)6(3)8/h5H,4H2,1-3H3/t5-/m1/s1 |
Synonyms: |
Ethyl 2-methylacetacetate;2-Methylacetoacetic acid ethyl ester;Alpha-(Aminomethyl)-4-Hydroxy-1,3-Benzenedimethanol;¦Á-Methyl acetoacetic acetate;
;ethyl 2-methyl-3-oxobutanoate;ethyl (2S)-2-methyl-3-oxobutanoate;ethyl (2R)-2-methyl-3-oxobutanoate; |
Molecular Structure: |
![Ethyl 2-methyl acetoacetate 609-14-3](https://images-a.chemnet.com/suppliers/chembase/148/1489.gif) |
if you are sourcing Ethyl 2-methyl acetoacetate from United-States ,just feel free to inquire