Details for 1-Bromo-2-chlorobenzene

1-Bromo-2-chlorobenzene
111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
694-80-4 |
EC NO: |
211-775-1;249-303-1 |
Molecular Formula: |
C6H4BrCl |
Molecular Weight: |
191.45 |
Specification: |
|
InChI: |
InChI=1/C6H4BrCl/c7-5-3-1-2-4-6(5)8/h1-4H |
Product description:
Clear, colorless liquid.May cause irritation of the digestive tract. The toxicological properties of this substance have not been fully investigated. |
Synonyms: |
Benzene, 1-bromo-2-chloro-;1-Bromo-2-chlorobenzene;1-Chloro-2-bromobenzene;2-Bromo-1-chlorobenzene;2-Chlorobromobenzene;AI3-31290;NSC 59694;o-Chlorobromobenzene;o-Bromochlorobenzene;Bromochlorobenzene;Benzene, bromochloro-;1-bromo-2-chlorobenzene; |
Molecular Structure: |
 |
if you are sourcing 1-Bromo-2-chlorobenzene from United-States ,just feel free to inquire