111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
88-09-5 |
EC NO: |
201-796-4 |
Molecular Formula: |
C6H11O2 |
Molecular Weight: |
115.1509 |
Specification: |
|
InChI: |
InChI=1/C6H12O2/c1-3-5(4-2)6(7)8/h5H,3-4H2,1-2H3,(H,7,8)/p-1 |
Product description:
Water-white liquid with a faint, unpleasant, fatty odor resembling butyric acid.Used in flavourings; as an intermediate for pharmaceuticals and dyestuffs; in the manufacture of esters and other chemicals. |
Synonyms: |
Pentane-3-carboxylic acid;Diethylacetic acid;2-Ethylbutanoic Acid;2-ethylbutanoate; |
Molecular Structure: |
 |