Details for Ethyl nicotinate
![](/images/home/newal1.gif)
Ethyl nicotinate
111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
614-18-6 |
EC NO: |
210-370-7 |
Molecular Formula: |
C8H9NO2 |
Molecular Weight: |
151.1626 |
Specification: |
|
InChI: |
InChI=1/C8H9NO2/c1-2-11-8(10)7-4-3-5-9-6-7/h3-6H,2H2,1H3 |
Synonyms: |
Ethyl pyridine-3-carboxylate;Nicotinic acid ethyl ester;Nicotinic acid ethylester;Ethyl nicotinoate;3-Picolinic Acid Ethyl Ester; |
Molecular Structure: |
![Ethyl nicotinate 614-18-6](https://images-a.chemnet.com/suppliers/chembase/149/1491.gif) |
if you are sourcing Ethyl nicotinate from United-States ,just feel free to inquire