Details for Ethyl Crotonate
Ethyl Crotonate
111Category: |
Fragrances and Aroma chemicals |
|
CAS NO: |
623-70-1 |
EC NO: |
210-808-7;234-125-9 |
Molecular Formula: |
C6H10O2 |
Molecular Weight: |
114.14 |
Specification: |
|
InChI: |
InChI=1/C6H10O2/c1-3-5-6(7)8-4-2/h3,5H,4H2,1-2H3/b5-3+ |
Synonyms: |
Crotonic acid ethyl ester;2-Butenoic acid methyl ester;Ethyl crotonate;2-butenoic acid, ethyl ester;Ethyl but-2-enoate;ethyl (2E)-but-2-enoate;ethyl (2Z)-but-2-enoate; |
Molecular Structure: |
|
if you are sourcing Ethyl Crotonate from United-States ,just feel free to inquire