Details for Methyl Crotonate
Methyl Crotonate
111Category: |
Catalyst and Auxiliary |
|
CAS NO: |
623-43-8 |
EC NO: |
210-793-7 |
Molecular Formula: |
C5H7O2 |
Molecular Weight: |
99.1084 |
Specification: |
|
InChI: |
InChI=1/C5H8O2/c1-3-4(2)5(6)7/h3H,1-2H3,(H,6,7)/p-1/b4-3+ |
Synonyms: |
Methyl crotonate, (Crotonic acid methyl ester);Methyl crotonate;Crotonic acid methyl ester;methyl but-2-enoate;methyl (2E)-but-2-enoate;methyl (2Z)-but-2-enoate;(2E)-2-methylbut-2-enoate;(E)-2-Butenoic acid methyl ester; |
Molecular Structure: |
|
if you are sourcing Methyl Crotonate from United-States ,just feel free to inquire