Details for Methyl Phenyl Glyoxylate

Methyl Phenyl Glyoxylate
111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
15206-55-0 |
EC NO: |
239-263-3 |
Molecular Formula: |
C9H8O3 |
Molecular Weight: |
164.158 |
Specification: |
|
InChI: |
InChI=1/C9H8O3/c1-12-9(11)8(10)7-5-3-2-4-6-7/h2-6H,1H3 |
Synonyms: |
Methyl phenylglyoxylate;Phenylglyoxylic acid methyl ester;IHT-PI MBF;Photoinitiator-MBF;Syna 468;Methyl benzoyl formate;Methyl-¦Á-oxo-phenylacetate;methyl oxo(phenyl)acetate;MBF; |
Molecular Structure: |
 |
if you are sourcing Methyl Phenyl Glyoxylate from United-States ,just feel free to inquire