Details for o-Cresyl Glycidyl Ether
o-Cresyl Glycidyl Ether
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
2210-79-9 |
EC NO: |
218-645-3 |
Molecular Formula: |
C10H12O2 |
Molecular Weight: |
164.2011 |
Specification: |
|
InChI: |
InChI=1/C10H12O2/c1-8-4-2-3-5-10(8)12-7-9-6-11-9/h2-5,9H,6-7H2,1H3/t9-/m0/s1 |
Synonyms: |
Glycidyl 2-methylphenyl ether;2,3-epoxypropyl o-tolyl ether;Glycidyl-(o-tolyl)-ether;Glycidyl o-cresyl ether~Glycidyl 2-methylphenyl ether;2-[(2-methylphenoxy)methyl]oxirane;(2R)-2-[(2-methylphenoxy)methyl]oxirane;(2S)-2-[(2-methylphenoxy)methyl]oxirane;2-Methylphenyl Glycidyl ether; |
Molecular Structure: |
|
if you are sourcing o-Cresyl Glycidyl Ether from United-States ,just feel free to inquire