Details for Acetyl Chloride

Acetyl Chloride
111Category: |
|
|
CAS NO: |
75-36-5 |
EC NO: |
200-865-6 |
Molecular Formula: |
C2H3ClO |
Molecular Weight: |
78.5 |
Specification: |
|
InChI: |
InChI=1/C2H3ClO/c1-2(3)4/h1H3 |
Product description:
A colorless, fuming liquid with a pungent odor.Acetylating agent, in testing for cholesterol, determination of water in organic liq. |
Synonyms: |
Acetic acid chloride;Acetic chloride;Ethanoyl chloride;ethanoyl chloride;Phosphor-free cetyl Chloride; |
Molecular Structure: |
 |
if you are sourcing Acetyl Chloride from United-States ,just feel free to inquire