Details for 2-Ethoxy-malonic acid diethyl ester

2-Ethoxy-malonic acid diethyl ester
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
37555-99-0 |
EC NO: |
|
Molecular Formula: |
C9H16O5 |
Molecular Weight: |
204.22 |
Specification: |
|
InChI: |
InChI=1S/C9H16O5/c1-4-12-7(8(10)13-5-2)9(11)14-6-3/h7H,4-6H2,1-3H3 |
Synonyms: |
Diethyl ethoxymalonate;propanedioic acid, 2-ethoxy-, diethyl ester;2-Ethoxy-malonic acid diethyl ester; |
Molecular Structure: |
 |
if you are sourcing 2-Ethoxy-malonic acid diethyl ester from United-States ,just feel free to inquire