Details for Allyl cyanoacetate
![](/images/home/newal1.gif)
Allyl cyanoacetate
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
13361-32-5 |
EC NO: |
236-423-4 |
Molecular Formula: |
C6H7NO2 |
Molecular Weight: |
125.1253 |
Specification: |
|
InChI: |
InChI=1/C6H7NO2/c1-2-5-9-6(8)3-4-7/h2H,1,3,5H2 |
Synonyms: |
Cyanoacetic acid allyl ester;ALLYL CYANOACETATE
CYANOACETIC ACID ALLYL ESTER;cyano-aceticaci2-propenylester;cyano-aceticaciallylester;Acetic acid, cyano-, 2-propenyl ester;prop-2-en-1-yl cyanoacetate; |
Molecular Structure: |
![Allyl cyanoacetate 13361-32-5](https://images-a.chemnet.com/suppliers/chembase/115/115820_1.gif) |
if you are sourcing Allyl cyanoacetate from United-States ,just feel free to inquire