Details for Methyl 4-nitrobenzoate
![](/images/home/newal1.gif)
Methyl 4-nitrobenzoate
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
619-50-1 |
EC NO: |
210-599-2 |
Molecular Formula: |
C8H6NO4 |
Molecular Weight: |
180.1381 |
Specification: |
|
InChI: |
InChI=1/C8H7NO4/c1-5-4-6(9(12)13)2-3-7(5)8(10)11/h2-4H,1H3,(H,10,11)/p-1 |
Synonyms: |
Methyl 4-nitrobenzoate/4-Nitrobenzoic acid methyl ester;4-Nitrobenzoic acid methyl ester;Methyl DL-p-Hydroxyphenylglycine;Methyl-p-nitrobenzoate;2-methyl-4-nitrobenzoate; |
Molecular Structure: |
![Methyl 4-nitrobenzoate 619-50-1](https://images-a.chemnet.com/suppliers/chembase/468/4687.gif) |
if you are sourcing Methyl 4-nitrobenzoate from United-States ,just feel free to inquire