Details for Indium Acetate

Indium Acetate
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
25114-58-3 |
EC NO: |
|
Molecular Formula: |
C2H3InO2 |
Molecular Weight: |
173.8609 |
Specification: |
|
InChI: |
InChI=1/C2H4O2.In/c1-2(3)4;/h1H3,(H,3,4);/q;+3/p-1 |
Product description:
- Molecular weight 291.88
- White colored needle - like crystalline powder
- Strong acetic acid (vinegar) smell
|
Synonyms: |
Indiumacetatewhitextl;Indium (III) acetate (99.99%-In) PURATREM;indium triacetate;acetate, indium salt (1:1); |
Molecular Structure: |
 |
if you are sourcing Indium Acetate from United-States ,just feel free to inquire