Details for 2-Vinylphenylboronic acid
2-Vinylphenylboronic acid
111Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
CAS NO: |
15016-42-9 |
EC NO: |
|
Molecular Formula: |
C8H9BO2 |
Molecular Weight: |
147.9669 |
Specification: |
|
InChI: |
InChI=1/C8H9BO2/c1-2-7-5-3-4-6-8(7)9(10)11/h2-6,10-11H,1H2 |
Synonyms: |
AKOS BRN-0141;2-BORONOSTYRENE;2-VINYLBENZENEBORONIC ACID;RARECHEM AH PB 0210;styrene-2-boronic acid;(2-ethenylphenyl)boronic acid; |
Molecular Structure: |
|
if you are sourcing 2-Vinylphenylboronic acid from United-States ,just feel free to inquire