Details for isopropyl isostearate

isopropyl isostearate
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
68171-33-5 |
EC NO: |
250-651-1 |
Molecular Formula: |
C21H42O2 |
Molecular Weight: |
326.561 |
Specification: |
|
InChI: |
InChI=1/C21H42O2/c1-19(2)17-15-13-11-9-7-5-6-8-10-12-14-16-18-21(22)23-20(3)4/h19-20H,5-18H2,1-4H3 |
Synonyms: |
Isopropyl isostearate;1-Methylethyl isooctadecanoate;2-Propyl isooctadecanoate;Isostearic acid, isopropyl ester;Nikkol IPIS;Wickenol 131;Isooctadecanoic acid, 1-methylethyl ester; |
Molecular Structure: |
 |
if you are sourcing isopropyl isostearate from United-States ,just feel free to inquire