Details for Benzyl Benzoate
![](/images/home/newal1.gif)
Benzyl Benzoate
111Category: |
Catalyst and Auxiliary |
|
CAS NO: |
120-51-4 |
EC NO: |
204-402-9 |
Molecular Formula: |
C14H12O2 |
Molecular Weight: |
212.2439 |
Specification: |
|
InChI: |
InChI=1/C14H12O2/c15-14(13-9-5-2-6-10-13)16-11-12-7-3-1-4-8-12/h1-10H,11H2 |
Synonyms: |
Benzoic acid benzyl ester;Ascabin;Ascabiol;Benylate;Benzyl alcohol benzoic ester;BENZOATO DE BENCILO;Benzoic acid phenylmethyl ester;Benzyl benzene carboxylate;Benzyl phenylformate;Phenylmethyl benzoate;Scabagen;Vanzoate;Benzyl benzoate BP; |
Molecular Structure: |
![Benzyl Benzoate 120-51-4](https://images-a.chemnet.com/suppliers/chembase/476/476.gif) |
if you are sourcing Benzyl Benzoate from United-States ,just feel free to inquire