Details for Dipropylene Glycol Monomethyl Ether
Dipropylene Glycol Monomethyl Ether
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
34590-94-8 |
EC NO: |
252-104-2 |
Molecular Formula: |
C7H16O3 |
Molecular Weight: |
148.2001 |
Specification: |
|
InChI: |
InChI=1/C7H16O3/c1-3-7(8)10-6-4-5-9-2/h7-8H,3-6H2,1-2H3 |
Synonyms: |
Di(propylene glycol) methyl ether;Methoxypropoxypropanol;Dipropylene glycol monomethyl ether;DPM; |
Molecular Structure: |
|
if you are sourcing Dipropylene Glycol Monomethyl Ether from United-States ,just feel free to inquire