Details for Manganese Acetate Tetrahydrate
Manganese Acetate Tetrahydrate
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
6156-78-1 |
EC NO: |
211-334-3 |
Molecular Formula: |
C2H11MnO6 |
Molecular Weight: |
186.0426 |
Specification: |
|
InChI: |
InChI=1/C2H4O2.Mn.4H2O/c1-2(3)4;;;;;/h1H3,(H,3,4);;4*1H2/q;+2;;;;/p-1 |
Synonyms: |
Manganese acetate tetrahydrate;Manganese ii acetate, tetrahydrate;manganese(2+) acetate hydrate (1:2:4);acetate, manganese(2+) salt, hydrate (1:1:4);Manganese acetate hydrate;Manganese(Ii) Acetate Tetrahydrate; |
Molecular Structure: |
|
if you are sourcing Manganese Acetate Tetrahydrate from United-States ,just feel free to inquire