Details for Ethyl Alpha-Bromophenylacetate
Ethyl Alpha-Bromophenylacetate
111Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
CAS NO: |
2882-19-1 |
EC NO: |
220-735-2 |
Molecular Formula: |
C10H11BrO2 |
Molecular Weight: |
243.0971 |
Specification: |
|
InChI: |
InChI=1/C10H11BrO2/c1-2-13-10(12)7-8-5-3-4-6-9(8)11/h3-6H,2,7H2,1H3 |
Synonyms: |
Benzeneacetic acid, alpha-bromo-, ethyl ester;Ethyl 2-bromo-2-phenylacetate;Ethyl alpha-bromophenyl acetate;ethyl (2R)-bromo(cyclohexyl)ethanoate;ethyl (2S)-bromo(cyclohexyl)ethanoate;ethyl (2-bromophenyl)acetate;Bromo-phenyl-acetic acid ethyl ester; |
Molecular Structure: |
|
if you are sourcing Ethyl Alpha-Bromophenylacetate from United-States ,just feel free to inquire