Details for Methyl 3-Mercaptopropionate
![](/images/home/newal1.gif)
Methyl 3-Mercaptopropionate
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
2935-90-2 |
EC NO: |
220-912-4 |
Molecular Formula: |
C4H8O2S |
Molecular Weight: |
120.1701 |
Specification: |
|
InChI: |
InChI=1/C4H8O2S/c1-6-4(5)2-3-7/h7H,2-3H2,1H3 |
Synonyms: |
3-Mercaptopropanoic Acid Methyl Ester;Methyl 3-mercaptopropanoate;3-Mercaptopropionic acid methyl ester;methyl 3-sulfanylpropanoate; |
Molecular Structure: |
![Methyl 3-Mercaptopropionate 2935-90-2](https://images-a.chemnet.com/suppliers/chembase/322/3226.gif) |
if you are sourcing Methyl 3-Mercaptopropionate from United-States ,just feel free to inquire