ChemNet > CAS > 110-49-6 2-Methoxyethyl acetate
110-49-6 2-Methoxyethyl acetate
| název výrobku |
2-Methoxyethyl acetate |
| Anglický název |
2-Methoxyethyl acetate; Methyl Cellosolve?acetate; 1-Acetoxy-2-methoxyethane; Ethylene glycol monomethyl ether acetate; Methyl Cellosolve(rg acetate; 2-sulfanylethyl acetate |
| Molekulární vzorec |
C4H8O2S |
| Molekulová hmotnost |
120.1701 |
| InChI |
InChI=1/C4H8O2S/c1-4(5)6-2-3-7/h7H,2-3H2,1H3 |
| Registrační číslo CAS |
110-49-6 |
| EINECS |
203-772-9 |
| Molekulární struktura |
|
| Hustota |
1.072g/cm3 |
| Bod tání |
-65℃ |
| Bod varu |
162.7°C at 760 mmHg |
| Index lomu |
1.452 |
| Bod vzplanutí |
57.6°C |
| Tlak par |
2.14mmHg at 25°C |
| Symbolů nebezpečnosti |
 T:Toxic;
|
| Riziko Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R60:May impair fertility.;
R61:May cause harm to the unborn child.;
|
| Bezpečnostní Popis |
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S53:Avoid exposure - obtain special instructions before use.;
|
|
