ChemNet > CAS > 1129-35-7 methyl 4-cyanobenzoate
1129-35-7 methyl 4-cyanobenzoate
název výrobku |
methyl 4-cyanobenzoate |
Anglický název |
methyl 4-cyanobenzoate; 4-Cyanobenzoic acid methyl ester; Cyanbenzoicacidmethylester; 4-Cy!nobenzoic acid methyl ester |
Molekulární vzorec |
C9H7NO2 |
Molekulová hmotnost |
161.1574 |
InChI |
InChI=1/C9H7NO2/c1-12-9(11)8-4-2-7(6-10)3-5-8/h2-5H,1H3 |
Registrační číslo CAS |
1129-35-7 |
EINECS |
214-443-4 |
Molekulární struktura |
|
Hustota |
1.18g/cm3 |
Bod tání |
62℃ |
Bod varu |
274.9°C at 760 mmHg |
Index lomu |
1.535 |
Bod vzplanutí |
131.2°C |
Tlak par |
0.00526mmHg at 25°C |
Symbolů nebezpečnosti |
|
Riziko Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Bezpečnostní Popis |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|