120-61-6 Dimethyl terephthalate
název výrobku |
Dimethyl terephthalate |
Anglický název |
Dimethyl terephthalate; D.M.T.; Terephthalic acid dimethyl ester; Benzene-1,4-dicarboxylic acid dimethyl ester; Terephthalic acid dimethyl ester; dimethyl cyclohexane-1,4-dicarboxylate; 1,3-benzodioxol-5-yl methylcarbamate; dimethyl benzene-1,4-dicarboxylate; 4-(methoxycarbonyl)benzoic acid; dimethyl benzene-1,2-dicarboxylate; DMT |
Molekulární vzorec |
C10H10O4 |
Molekulová hmotnost |
194.184 |
InChI |
InChI=1/C10H10O4/c1-13-9(11)7-5-3-4-6-8(7)10(12)14-2/h3-6H,1-2H3 |
Registrační číslo CAS |
120-61-6 |
EINECS |
204-411-8 |
Molekulární struktura |
|
Hustota |
1.175g/cm3 |
Bod tání |
140-143℃ |
Bod varu |
282.7°C at 760 mmHg |
Index lomu |
1.514 |
Bod vzplanutí |
146.7°C |
Tlak par |
0.00331mmHg at 25°C |
Symbolů nebezpečnosti |
|
Riziko Codes |
|
Bezpečnostní Popis |
S24/25:Avoid contact with skin and eyes.;
|
|