ChemNet > CAS > 13294-71-8 2-Bromo-2-butene, mixture of cis and trans
13294-71-8 2-Bromo-2-butene, mixture of cis and trans
| název výrobku |
2-Bromo-2-butene, mixture of cis and trans |
| Anglický název |
2-Bromo-2-butene, mixture of cis and trans; 2-Bromo-2-butene (cis+trans); Bromobutenecistrans; 2-Bromo-2-butene; 2-bromobut-2-ene; (2Z)-2-bromobut-2-ene; (2E)-2-bromobut-2-ene |
| Molekulární vzorec |
C4H7Br |
| Molekulová hmotnost |
135.0024 |
| InChI |
InChI=1/C4H7Br/c1-3-4(2)5/h3H,1-2H3/b4-3+ |
| Registrační číslo CAS |
13294-71-8 |
| EINECS |
236-316-2 |
| Molekulární struktura |
|
| Hustota |
1.334g/cm3 |
| Bod varu |
93.9°C at 760 mmHg |
| Index lomu |
1.469 |
| Bod vzplanutí |
13.6°C |
| Tlak par |
55.2mmHg at 25°C |
| Symbolů nebezpečnosti |
 F:Highly flammable;
|
| Riziko Codes |
R11:Highly flammable.;
|
| Bezpečnostní Popis |
S16:Keep away from sources of ignition - No smoking.;
|
|
