139-87-7 N-Ethyldiethanolamine
název výrobku |
N-Ethyldiethanolamine |
Anglický název |
N-Ethyldiethanolamine; 2,2-(Ethylimino)diethanol; Ethyldiethanolamine; N-ethyl-2-hydroxy-N-(2-hydroxyethyl)ethanaminium |
Molekulární vzorec |
C6H16NO2 |
Molekulová hmotnost |
134.1962 |
InChI |
InChI=1/C6H15NO2/c1-2-7(3-5-8)4-6-9/h8-9H,2-6H2,1H3/p+1 |
Registrační číslo CAS |
139-87-7 |
EINECS |
205-379-8 |
Molekulární struktura |
|
Bod tání |
-50℃ |
Bod varu |
246.4°C at 760 mmHg |
Bod vzplanutí |
123.9°C |
Tlak par |
0.00449mmHg at 25°C |
Symbolů nebezpečnosti |
Xi:Irritant;
|
Riziko Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpečnostní Popis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|