ChemNet > CAS > 14064-83-6 4-hydroxy-4'-nitrostilben
14064-83-6 4-hydroxy-4'-nitrostilben
| název výrobku |
4-hydroxy-4'-nitrostilben |
| Synonyma |
; 4-[2-(nitrofenyl)ethenyl]fenol; 4-[2-(4-nitrofenyl)ethenyl]fenol; 4-[(E)-2-(4-nitrofenyl)ethenyl]fenol |
| Anglický název |
4-Hydroxy-4'-nitrostilbene; 4-[2-(Nitrophenyl)ethenyl]phenol; 4-[2-(4-nitrophenyl)ethenyl]phenol; 4-[(E)-2-(4-nitrophenyl)ethenyl]phenol |
| Molekulární vzorec |
C14H11NO3 |
| Molekulová hmotnost |
241.242 |
| InChI |
InChI=1/C14H11NO3/c16-14-9-5-12(6-10-14)2-1-11-3-7-13(8-4-11)15(17)18/h1-10,16H/b2-1+ |
| Registrační číslo CAS |
14064-83-6 |
| Molekulární struktura |
|
| Hustota |
1.318g/cm3 |
| Bod varu |
389.8°C at 760 mmHg |
| Index lomu |
1.717 |
| Bod vzplanutí |
164.5°C |
| Tlak par |
1.23E-06mmHg at 25°C |
| Symbolů nebezpečnosti |
|
| Riziko Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpečnostní Popis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
