ChemNet > CAS > 1575-74-2 2-Methylpent-4-enoic acid
1575-74-2 2-Methylpent-4-enoic acid
| název výrobku |
2-Methylpent-4-enoic acid |
| Anglický název |
2-Methylpent-4-enoic acid; 2-Methyl-4-pentenoic acid; (2S)-2-methylpent-4-enoate; (2R)-2-methylpent-4-enoate |
| Molekulární vzorec |
C6H9O2 |
| Molekulová hmotnost |
113.135 |
| InChI |
InChI=1/C6H10O2/c1-3-4-5(2)6(7)8/h3,5H,1,4H2,2H3,(H,7,8)/p-1/t5-/m1/s1 |
| Registrační číslo CAS |
1575-74-2 |
| EINECS |
216-404-7 |
| Molekulární struktura |
|
| Bod varu |
190.6°C at 760 mmHg |
| Bod vzplanutí |
88.1°C |
| Tlak par |
0.237mmHg at 25°C |
| Symbolů nebezpečnosti |
 C:Corrosive;
|
| Riziko Codes |
R34:Causes burns.;
|
| Bezpečnostní Popis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
