ChemNet > CAS > 1721-26-2 ethyl 2-methylnicotinate
1721-26-2 ethyl 2-methylnicotinate
název výrobku |
ethyl 2-methylnicotinate |
Anglický název |
ethyl 2-methylnicotinate; Ethyl 2-methylpyridine-3-carboxylate~2-Methylnicotinic acid ethyl ester; 2-Methylnicotinic acid ethyl ester; ethyl 2-methylpyridine-3-carboxylate |
Molekulární vzorec |
C9H11NO2 |
Molekulová hmotnost |
165.1891 |
InChI |
InChI=1/C9H11NO2/c1-3-12-9(11)8-5-4-6-10-7(8)2/h4-6H,3H2,1-2H3 |
Registrační číslo CAS |
1721-26-2 |
EINECS |
217-013-4 |
Molekulární struktura |
|
Hustota |
1.077g/cm3 |
Bod varu |
234.7°C at 760 mmHg |
Index lomu |
1.506 |
Bod vzplanutí |
86°C |
Tlak par |
0.0521mmHg at 25°C |
Symbolů nebezpečnosti |
|
Riziko Codes |
R36/38:Irritating to eyes and skin.;
|
Bezpečnostní Popis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|